| id | C00021143 |
|---|---|
| Name | Aromatin |
| CAS RN | 6754-14-9 |
| Standard InChI | InChI=1S/C15H18O3/c1-8-6-12-10(9(2)14(17)18-12)7-15(3)11(8)4-5-13(15)16/h4-5,8,10-12H,2,6-7H2,1,3H3/t8-,10-,11+,12-,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H18O3/c1-8-6-12-10(9(2)14(17)18-12)7-15(3)11(8)4-5-13(15)16/h4-5,8,10-12H,2,6-7H2,1,3H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 495 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL494255 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Helenium aromaticum | 53720 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17861 | X-box-binding protein 1 | Unclassified protein | CHEMBL494255 |
CHEMBL1738682
(1)
|
1 / 0 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL494255 |
CHEMBL2114784
(1)
|
1 / 1 |
| P42858 | Huntingtin | Unclassified protein | CHEMBL494255 |
CHEMBL1613918
(1)
|
1 / 1 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL494255 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL494255 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P51151 | Ras-related protein Rab-9A | Unclassified protein | CHEMBL494255 |
CHEMBL1613838
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL494255 |
CHEMBL2114788
(1)
|
0 / 0 |
| Q9HC16 | DNA dC->dU-editing enzyme APOBEC-3G | Enzyme | CHEMBL494255 |
CHEMBL1963863
(1)
|
0 / 0 |
| Q00987 | E3 ubiquitin-protein ligase Mdm2 | Other nuclear protein | CHEMBL494255 |
CHEMBL1613898
(1)
|
1 / 5 |
| O15118 | Niemann-Pick C1 protein | Unclassified protein | CHEMBL494255 |
CHEMBL1614342
(1)
|
1 / 1 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL494255 |
CHEMBL1738588
(1)
CHEMBL1738317
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL494255 |
CHEMBL1794483
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL494255 |
CHEMBL1614250
(1)
CHEMBL1614421
(1)
|
4 / 3 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL494255 |
CHEMBL1738184
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL494255 |
CHEMBL2354311
(1)
|
1 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614401 | Accelerated tumor formation, susceptibility to; actfs |
Q00987
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #137800 | Glioma susceptibility 1; glm1 |
O75874
|
| #143100 | Huntington disease; hd |
P42858
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #612371 | Major affective disorder 7; mafd7 |
P17861
|
| #257220 | Niemann-pick disease, type c1; npc1 |
O15118
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00136 | Niemann-Pick disease type C (NPC) |
O15118
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00059 | Huntington's disease (HD) |
P42858
(related)
|
| H00025 | Penile cancer |
Q00987
(related)
|
| H00028 | Choriocarcinoma |
Q00987
(related)
|
| H00036 | Osteosarcoma |
Q00987
(related)
|
| H00037 | Alveolar rhabdomyosarcoma |
Q00987
(related)
|
| H00042 | Glioma |
Q00987
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|