| id | C00021177 |
|---|---|
| Name | 6beta-Hydroxypulchellin 2-O-acetate |
| CAS RN | 16434-63-2 |
| Standard InChI | InChI=1S/C17H24O6/c1-7-5-10-13(8(2)16(21)23-10)15(20)17(4)12(19)6-11(14(7)17)22-9(3)18/h7,10-15,19-20H,2,5-6H2,1,3-4H3/t7-,10+,11+,12-,13-,14-,15-,17-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H24O6/c1-7-5-10-13(8(2)16(21)23-10)15(20)17(4)12(19)6-11(14(7)17)22-9(3)18/h7,10-15,19-20H,2,5-6H2,1,3-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 303 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL520363 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Loxothysanus sinuatus | 176551 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL520363 |
CHEMBL861583
(1)
|
0 / 0 |