| id | C00021388 | 
|---|---|
| Name | Teferin | 
| CAS RN | 54526-95-3 | 
| Standard InChI | InChI=1S/C23H32O5/c1-14(2)23(26)11-10-22(4)9-8-15(3)12-19(20(22)23)28-21(25)16-6-7-17(24)18(13-16)27-5/h6-8,13-14,19-20,24,26H,9-12H2,1-5H3/t19-,20+,22-,23+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C23H32O5/c1-14(2)23(26)11-10-22(4)9-8-15(3)12-19(20(22)23)28-21(25)16-6-7-17(24)18(13-16)27-5/h6-8,13-14,19-20,24,26H,9-12H2,1-5H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 327 | 
| By standard InChI | CHEMBL464467 | 
|---|---|
| By standard InChI Main Layer | CHEMBL464467 CHEMBL1552750 CHEMBL1967912 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Ferula tenuisecta | 82087 | Apiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1552750 | CHEMBL1614110
                        (1) | 1 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL464467 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL464467 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1552750 | CHEMBL1614027
                        (1) | 0 / 1 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL464467 | CHEMBL1794584
                        (1) | 2 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL464467 | CHEMBL2114788
                        (1) | 0 / 0 | 
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1552750 | CHEMBL1614227
                        (1) | 3 / 3 | 
| P03372 | Estrogen receptor | NR3A1 | CHEMBL464467 | CHEMBL1004750
                        (1) | 1 / 1 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1552750 | CHEMBL1613777
                        (1) | 1 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency | Q99714 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #615363 | Estrogen resistance; estrr | P03372 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #300705 | Mental retardation, x-linked 17; mrx17 | Q99714 | 
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 | Q99714 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00026 | Endometrial Cancer | P03372
                            (marker) | 
| H01205 | Coumarin resistance | P11712
                            (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) | 
| H00480 | Non-syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00658 | Syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency | Q99714
                            (related) |