| id | C00021488 |
|---|---|
| Name | Illudalic acid |
| CAS RN | 18508-77-5 |
| Standard InChI | InChI=1S/C15H16O5/c1-15(2)4-8-9(5-15)13(18)10(6-16)7-3-11(17)20-14(19)12(7)8/h6,11,17-18H,3-5H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H16O5/c1-15(2)4-8-9(5-15)13(18)10(6-16)7-3-11(17)20-14(19)12(7)8/h6,11,17-18H,3-5H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7081 |
| By standard InChI | CHEMBL506661 |
|---|---|
| By standard InChI Main Layer | CHEMBL506661 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Tricholomataceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Clitocybe illudens | 50966 | Tricholomataceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10586 | Receptor-type tyrosine-protein phosphatase F | Receptor tyrosine-protein phosphatase | CHEMBL506661 |
CHEMBL981145
(1)
|
0 / 0 |