| id | C00000215 |
|---|---|
| Name | Caulerpin |
| CAS RN | 26612-48-6 |
| Standard InChI | InChI=1S/C24H18N2O4/c1-29-23(27)17-11-15-13-7-3-6-10-20(13)26-22(15)18(24(28)30-2)12-16-14-8-4-5-9-19(14)25-21(16)17/h3-12,25-26H,1-2H3/b15-11-,16-12-,17-11+,18-12+,21-17-,22-18- |
| Standard InChI (Main Layer) | InChI=1S/C24H18N2O4/c1-29-23(27)17-11-15-13-7-3-6-10-20(13)26-22(15)18(24(28)30-2)12-16-14-8-4-5-9-19(14)25-21(16)17/h3-12,25-26H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2329 |
| By standard InChI | CHEMBL377236 |
|---|---|
| By standard InChI Main Layer | CHEMBL377236 |
| By LinkDB | C17097 |
|---|
| By CAS RN | C000392 |
|---|
| class name | count |
|---|---|
| Viridiplantae | 2 |
| family name | count |
|---|---|
| Caulerpaceae | 2 |
| Rhodomelaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Caulerpa racemosa | 76317 | Caulerpaceae | Viridiplantae | Viridiplantae |
| Caulerpa sertularioides | 76315 | Caulerpaceae | Viridiplantae | Viridiplantae |
| Chondria armata | 860625 | Rhodomelaceae | Eukaryota |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL377236 |
CHEMBL871236
(1)
|
0 / 0 |