| id | C00021516 |
|---|---|
| Name | Pterosin S |
| CAS RN | 56227-00-0 |
| Standard InChI | InChI=1S/C14H18O4/c1-7-5-10-12(14(18)8(2)13(10)17)11(6-16)9(7)3-4-15/h5,8,13,15-17H,3-4,6H2,1-2H3/t8-,13-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C14H18O4/c1-7-5-10-12(14(18)8(2)13(10)17)11(6-16)9(7)3-4-15/h5,8,13,15-17H,3-4,6H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 870 |
| By standard InChI | CHEMBL1864404 |
|---|---|
| By standard InChI Main Layer | CHEMBL1864404 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Euphyllophyta | 2 |
| family name | count |
|---|---|
| Pteridaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pteris kiuschiuensis | 872841 | Pteridaceae | Euphyllophyta | Viridiplantae |
| Pteris kiushinensis | 13820 | Pteridaceae | Euphyllophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL1864404 |
CHEMBL2354282
(1)
|
4 / 2 |
| O75496 | Geminin | Unclassified protein | CHEMBL1864404 |
CHEMBL2114780
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1864404 |
CHEMBL1794483
(1)
|
0 / 0 |