| id | C00000217 | 
|---|---|
| Name | Hydrangenol / 3,4-Dihydro-8-hydroxy-3-(4-hydroxyphenyl)-H-2-benzopyran-1-one | 
| CAS RN | 480-47-7 | 
| Standard InChI | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 | 
| Standard InChI (Main Layer) | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 | 
| Phytochemical cluster | No. 29 | 
|---|---|
| KCF-S cluster | No. 1122 | 
| By standard InChI | CHEMBL69299 | 
|---|---|
| By standard InChI Main Layer | CHEMBL69299 CHEMBL1475427 | 
| By LinkDB | C10262 | 
|---|
| By CAS RN | C023818 | 
|---|
| class name | count | 
|---|---|
| asterids | 2 | 
| family name | count | 
|---|---|
| Hydrangeaceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Hydrangea chinensis | 498914 | Hydrangeaceae | asterids | Viridiplantae | 
| Hydrangea macrophylla | 23110 | Hydrangeaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1475427 | CHEMBL2354287
                        (1) | 1 / 1 |