| id | C00000217 |
|---|---|
| Name | Hydrangenol / 3,4-Dihydro-8-hydroxy-3-(4-hydroxyphenyl)-H-2-benzopyran-1-one |
| CAS RN | 480-47-7 |
| Standard InChI | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
| Standard InChI (Main Layer) | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
| Phytochemical cluster | No. 29 |
|---|---|
| KCF-S cluster | No. 1122 |
| By standard InChI | CHEMBL69299 |
|---|---|
| By standard InChI Main Layer | CHEMBL69299 CHEMBL1475427 |
| By LinkDB | C10262 |
|---|
| By CAS RN | C023818 |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Hydrangeaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hydrangea chinensis | 498914 | Hydrangeaceae | asterids | Viridiplantae |
| Hydrangea macrophylla | 23110 | Hydrangeaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1475427 |
CHEMBL2354287
(1)
|
1 / 1 |