id | C00000217 |
---|---|
Name | Hydrangenol / 3,4-Dihydro-8-hydroxy-3-(4-hydroxyphenyl)-H-2-benzopyran-1-one |
CAS RN | 480-47-7 |
Standard InChI | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
Standard InChI (Main Layer) | InChI=1S/C15H12O4/c16-11-6-4-9(5-7-11)13-8-10-2-1-3-12(17)14(10)15(18)19-13/h1-7,13,16-17H,8H2 |
Phytochemical cluster | No. 29 |
---|---|
KCF-S cluster | No. 1122 |
By standard InChI | CHEMBL69299 |
---|---|
By standard InChI Main Layer | CHEMBL69299 CHEMBL1475427 |
By LinkDB | C10262 |
---|
By CAS RN | C023818 |
---|
class name | count |
---|---|
asterids | 2 |
family name | count |
---|---|
Hydrangeaceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Hydrangea chinensis | 498914 | Hydrangeaceae | asterids | Viridiplantae |
Hydrangea macrophylla | 23110 | Hydrangeaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1475427 |
CHEMBL2354287
(1)
|
1 / 1 |