| id | C00021932 |
|---|---|
| Name | Mexicanin D / Neohelenaline |
| CAS RN | 5945-70-0 |
| Standard InChI | InChI=1S/C15H18O4/c1-6-4-11-13(8(3)15(18)19-11)14(17)9-5-10(16)7(2)12(6)9/h6,9,11,13-14,17H,3-5H2,1-2H3/t6-,9+,11-,13-,14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H18O4/c1-6-4-11-13(8(3)15(18)19-11)14(17)9-5-10(16)7(2)12(6)9/h6,9,11,13-14,17H,3-5H2,1-2H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 601 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Helenium mexicanum | 53720 | Asteraceae | asterids | Viridiplantae |
| Helenium ooclinium | 53720 | Asteraceae | asterids | Viridiplantae |