| id | C00022094 |
|---|---|
| Name | 16-Hydroxygeranylgeraniol |
| CAS RN | 79577-80-3 |
| Standard InChI | InChI=1S/C20H34O2/c1-17(10-6-12-19(3)14-15-21)8-5-9-18(2)11-7-13-20(4)16-22/h9-10,13-14,21-22H,5-8,11-12,15-16H2,1-4H3/b17-10+,18-9+,19-14+,20-13+ |
| Standard InChI (Main Layer) | InChI=1S/C20H34O2/c1-17(10-6-12-19(3)14-15-21)8-5-9-18(2)11-7-13-20(4)16-22/h9-10,13-14,21-22H,5-8,11-12,15-16H2,1-4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 369 |
| By standard InChI | CHEMBL471477 |
|---|---|
| By standard InChI Main Layer | CHEMBL471477 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| Gyrodontaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Boletinus cavipes | 85973 | Gyrodontaceae | Fungi | |
| Mikania goyazensis | 102786 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL471477 |
CHEMBL999197
(1)
CHEMBL999198
(1)
|
1 / 1 |