| id | C00022591 |
|---|---|
| Name | 3,4-Dimethoxypropiophenone |
| CAS RN | 1835-04-7 |
| Standard InChI | InChI=1S/C11H14O3/c1-4-9(12)8-5-6-10(13-2)11(7-8)14-3/h5-7H,4H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H14O3/c1-4-9(12)8-5-6-10(13-2)11(7-8)14-3/h5-7H,4H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2959 |
| By standard InChI | CHEMBL479685 |
|---|---|
| By standard InChI Main Layer | CHEMBL479685 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pteronia camphorata | 382043 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL479685 |
CHEMBL2114788
(1)
|
0 / 0 |