| id | C00000226 |
|---|---|
| Name | (+)-9,10-Dihydro-7-iso-jasmonic acid |
| CAS RN | 39647-11-5 |
| Standard InChI | InChI=1S/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C13H22O3/c1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h10-11H,3-9H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3198 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1530328 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Botryosphaeriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Botryodiplodia theobromae | 45133 | Botryosphaeriaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1530328 |
CHEMBL2354287
(1)
|
1 / 1 |