| id | C00002302 |
|---|---|
| Name | Scopoline |
| CAS RN | 487-27-4 |
| Standard InChI | InChI=1S/C8H13NO2/c1-9-5-2-4-3-6(9)8(11-4)7(5)10/h4-8,10H,2-3H2,1H3/t4-,5?,6?,7?,8-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C8H13NO2/c1-9-5-2-4-3-6(9)8(11-4)7(5)10/h4-8,10H,2-3H2,1H3 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 8310 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1394721 |
| By LinkDB | C10866 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Solanaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Solandra grandiflora | 33123 | Solanaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1394721 |
CHEMBL1614250
(1)
|
4 / 3 |