| id | C00002331 | 
|---|---|
| Name | Cryptopleurine / (-)-Cryptopleurine | 
| CAS RN | 482-22-4 | 
| Standard InChI | InChI=1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3/t15-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 410 | 
| By standard InChI | CHEMBL198075 | 
|---|---|
| By standard InChI Main Layer | CHEMBL198075 CHEMBL270213 CHEMBL1958069 | 
| By LinkDB | C10586 | 
|---|
| By CAS RN | C007160 | 
|---|
| class name | count | 
|---|---|
| rosids | 3 | 
| Magnoliophyta | 1 | 
| family name | count | 
|---|---|
| Urticaceae | 2 | 
| Lauraceae | 1 | 
| Vitaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Boehmeria cylindrica | 83905 | Urticaceae | rosids | Viridiplantae | 
| Boehmeria pannosa | 1049918 | Urticaceae | rosids | Viridiplantae | 
| Cissus rheifolia | 149357 | Vitaceae | rosids | Viridiplantae | 
| Cryptocaria pleurosperma | ||||
| Cryptocarya pleurosperma | 1312791 | Lauraceae | Magnoliophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL198075 | 
                        CHEMBL967268
                        (1)
                         | 
                      0 / 0 | 
| P27540 | Aryl hydrocarbon receptor nuclear translocator | Unclassified protein | CHEMBL198075 | 
                        CHEMBL967264
                        (1)
                         | 
                      0 / 0 |