| id | C00002331 |
|---|---|
| Name | Cryptopleurine / (-)-Cryptopleurine |
| CAS RN | 482-22-4 |
| Standard InChI | InChI=1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3/t15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 410 |
| By standard InChI | CHEMBL198075 |
|---|---|
| By standard InChI Main Layer | CHEMBL198075 CHEMBL270213 CHEMBL1958069 |
| By LinkDB | C10586 |
|---|
| By CAS RN | C007160 |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Urticaceae | 2 |
| Lauraceae | 1 |
| Vitaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Boehmeria cylindrica | 83905 | Urticaceae | rosids | Viridiplantae |
| Boehmeria pannosa | 1049918 | Urticaceae | rosids | Viridiplantae |
| Cissus rheifolia | 149357 | Vitaceae | rosids | Viridiplantae |
| Cryptocaria pleurosperma | ||||
| Cryptocarya pleurosperma | 1312791 | Lauraceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL198075 |
CHEMBL967268
(1)
|
0 / 0 |
| P27540 | Aryl hydrocarbon receptor nuclear translocator | Unclassified protein | CHEMBL198075 |
CHEMBL967264
(1)
|
0 / 0 |