| id | C00002339 |
|---|---|
| Name | Ficine |
| CAS RN | 2520-36-7 |
| Standard InChI | InChI=1S/C20H19NO4/c1-21-9-5-8-13(21)18-14(22)10-15(23)19-16(24)11-17(25-20(18)19)12-6-3-2-4-7-12/h2-4,6-7,10-11,13,22-23H,5,8-9H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H19NO4/c1-21-9-5-8-13(21)18-14(22)10-15(23)19-16(24)11-17(25-20(18)19)12-6-3-2-4-7-12/h2-4,6-7,10-11,13,22-23H,5,8-9H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2523 |
| By standard InChI | CHEMBL2029617 |
|---|---|
| By standard InChI Main Layer | CHEMBL2029617 CHEMBL2029618 CHEMBL2029619 |
| By LinkDB | C10594 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ficus pantoniana | 479811 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q00535 | Cyclin-dependent kinase 5 | Cdk5 | CHEMBL2029617 CHEMBL2029618 CHEMBL2029619 |
CHEMBL2032664
(3)
|
0 / 0 |
| Q15078 | Cyclin-dependent kinase 5 activator 1 | REG serine/threonine protein kinase family | CHEMBL2029617 CHEMBL2029618 CHEMBL2029619 |
CHEMBL2032664
(3)
|
0 / 0 |