| id | C00023427 | 
|---|---|
| Name | (-)-Sclareolide / ent-Norambreinolide | 
| CAS RN | 95406-08-9 | 
| Standard InChI | InChI=1S/C16H26O2/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-13(17)18-16/h11-12H,5-10H2,1-4H3/t11-,12+,15-,16+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C16H26O2/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-13(17)18-16/h11-12H,5-10H2,1-4H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1139 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL304461 CHEMBL1437047 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Sideritis nutans | 403027 | Lamiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1437047 | CHEMBL1614281
                        (1)
                        CHEMBL1614361
                        (1) | 3 / 2 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1437047 | CHEMBL1614027
                        (1) | 0 / 1 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1437047 | CHEMBL1614458
                        (1) | 0 / 0 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1437047 | CHEMBL1613777
                        (1) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1437047 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL304461 | CHEMBL1794483
                        (1) | 0 / 0 |