id | C00002343 |
---|---|
Name | Himbacine |
CAS RN | 6879-74-9 |
Standard InChI | InChI=1S/C22H35NO2/c1-14-7-6-9-17(23(14)3)11-12-19-18-10-5-4-8-16(18)13-20-21(19)15(2)25-22(20)24/h11-12,14-21H,4-10,13H2,1-3H3/b12-11+/t14-,15+,16-,17+,18+,19-,20+,21-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C22H35NO2/c1-14-7-6-9-17(23(14)3)11-12-19-18-10-5-4-8-16(18)13-20-21(19)15(2)25-22(20)24/h11-12,14-21H,4-10,13H2,1-3H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 8163 |
By standard InChI | CHEMBL318849 |
---|---|
By standard InChI Main Layer | CHEMBL277642 CHEMBL58824 CHEMBL301670 CHEMBL57485 CHEMBL56275 CHEMBL55698 CHEMBL97765 CHEMBL99618 CHEMBL318849 CHEMBL433566 CHEMBL1993504 |
By LinkDB | C10598 |
---|
By CAS RN | C048172 |
---|
class name | count |
---|---|
Magnoliophyta | 2 |
family name | count |
---|---|
Himantandraceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Himantandra baccata | 22300 | Himantandraceae | Magnoliophyta | Viridiplantae |
Himantandra belgraveana | 22300 | Himantandraceae | Magnoliophyta | Viridiplantae |
OMIM | preferred title | UniProt |
---|---|---|
#100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
#103780 | Alcohol dependence |
P08172
|
#608516 | Major depressive disorder; mdd |
P08172
|