| id | C00002343 |
|---|---|
| Name | Himbacine |
| CAS RN | 6879-74-9 |
| Standard InChI | InChI=1S/C22H35NO2/c1-14-7-6-9-17(23(14)3)11-12-19-18-10-5-4-8-16(18)13-20-21(19)15(2)25-22(20)24/h11-12,14-21H,4-10,13H2,1-3H3/b12-11+/t14-,15+,16-,17+,18+,19-,20+,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H35NO2/c1-14-7-6-9-17(23(14)3)11-12-19-18-10-5-4-8-16(18)13-20-21(19)15(2)25-22(20)24/h11-12,14-21H,4-10,13H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8163 |
| By standard InChI | CHEMBL318849 |
|---|---|
| By standard InChI Main Layer | CHEMBL277642 CHEMBL58824 CHEMBL301670 CHEMBL57485 CHEMBL56275 CHEMBL55698 CHEMBL97765 CHEMBL99618 CHEMBL318849 CHEMBL433566 CHEMBL1993504 |
| By LinkDB | C10598 |
|---|
| By CAS RN | C048172 |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 2 |
| family name | count |
|---|---|
| Himantandraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Himantandra baccata | 22300 | Himantandraceae | Magnoliophyta | Viridiplantae |
| Himantandra belgraveana | 22300 | Himantandraceae | Magnoliophyta | Viridiplantae |
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
| #103780 | Alcohol dependence |
P08172
|
| #608516 | Major depressive disorder; mdd |
P08172
|