| id | C00002348 |
|---|---|
| Name | Lunarine |
| CAS RN | 24185-51-1 |
| Standard InChI | InChI=1S/C25H31N3O4/c29-19-8-10-25-11-9-24(31)27-14-2-1-12-26-13-3-15-28-23(30)7-5-18-4-6-21(20(25)16-18)32-22(25)17-19/h4-7,9,11,16,22,26H,1-3,8,10,12-15,17H2,(H,27,31)(H,28,30)/b7-5+,11-9+/t22-,25+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H31N3O4/c29-19-8-10-25-11-9-24(31)27-14-2-1-12-26-13-3-15-28-23(30)7-5-18-4-6-21(20(25)16-18)32-22(25)17-19/h4-7,9,11,16,22,26H,1-3,8,10,12-15,17H2,(H,27,31)(H,28,30) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7766 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL511447 CHEMBL1436733 |
| By LinkDB | C10603 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Brassicaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lunaria biennis | 153658 | Brassicaceae | rosids | Viridiplantae |
| Lunaria rediviva | 283746 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL1436733 |
CHEMBL1794467
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1436733 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |