| id | C00023480 |
|---|---|
| Name | ent-17-Hydroxy-3,13Z-clerodadien-15-al |
| CAS RN | |
| Standard InChI | InChI=1S/C20H32O2/c1-15(10-13-21)8-11-20(4)17(14-22)9-12-19(3)16(2)6-5-7-18(19)20/h6,10,13,17-18,22H,5,7-9,11-12,14H2,1-4H3/b15-10-/t17-,18-,19-,20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H32O2/c1-15(10-13-21)8-11-20(4)17(14-22)9-12-19(3)16(2)6-5-7-18(19)20/h6,10,13,17-18,22H,5,7-9,11-12,14H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 221 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Symphyopappus reticulatus | 4210 | Asteraceae | asterids | Viridiplantae |