| id | C00002357 |
|---|---|
| Name | Pithecolobine |
| CAS RN | 22368-82-7 |
| Standard InChI | InChI=1S/C22H46N4O/c1-2-3-4-5-6-7-8-13-21-20-22(27)26-19-12-17-24-15-10-9-14-23-16-11-18-25-21/h21,23-25H,2-20H2,1H3,(H,26,27) |
| Standard InChI (Main Layer) | InChI=1S/C22H46N4O/c1-2-3-4-5-6-7-8-13-21-20-22(27)26-19-12-17-24-15-10-9-14-23-16-11-18-25-21/h21,23-25H,2-20H2,1H3,(H,26,27) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 492 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C10611 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pithecolobium saman | ||||
| Samanea saman | 76910 | Fabaceae | rosids | Viridiplantae |