| id | C00002414 |
|---|---|
| Name | Vignafuran / 2-(4-Hydroxy-2-methoxyphenyl)-6-methoxybenzofuran |
| CAS RN | 57800-41-6 |
| Standard InChI | InChI=1S/C16H14O4/c1-18-12-5-3-10-7-16(20-14(10)9-12)13-6-4-11(17)8-15(13)19-2/h3-9,17H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-18-12-5-3-10-7-16(20-14(10)9-12)13-6-4-11(17)8-15(13)19-2/h3-9,17H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 210 |
| By standard InChI | CHEMBL233767 |
|---|---|
| By standard InChI Main Layer | CHEMBL233767 |
| By LinkDB | C08993 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lablab niger | 271790 | Fabaceae | rosids | Viridiplantae |
| Lablab purpureus | 35936 | Fabaceae | rosids | Viridiplantae |
| Vigna unguiculata | 3917 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL233767 |
CHEMBL896500
(1)
|
0 / 0 |