| id | C00024179 | 
|---|---|
| Name | Heteroclitin D | 
| CAS RN | 140369-76-2 | 
| Standard InChI | InChI=1S/C27H30O8/c1-7-13(2)26(29)35-21-15(4)14(3)8-16-9-18(30-5)23(31-6)25(28)27(16)11-32-24-20(27)17(21)10-19-22(24)34-12-33-19/h7,9-10,14-15,21H,8,11-12H2,1-6H3/b13-7+/t14-,15-,21+,27+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C27H30O8/c1-7-13(2)26(29)35-21-15(4)14(3)8-16-9-18(30-5)23(31-6)25(28)27(16)11-32-24-20(27)17(21)10-19-22(24)34-12-33-19/h7,9-10,14-15,21H,8,11-12H2,1-6H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1294 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL485478 CHEMBL1444176 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Magnoliophyta | 2 | 
| family name | count | 
|---|---|
| Schisandraceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Kadsura heteroclita (ROXB.) CRAIB. | 105749 | Schisandraceae | Magnoliophyta | Viridiplantae | 
| Kadsura interior | 105749 | Schisandraceae | Magnoliophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P06746 | DNA polymerase beta | Enzyme | CHEMBL1444176 | CHEMBL1614079
                        (1) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL1444176 | CHEMBL2114843
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1444176 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL1444176 | CHEMBL2114810
                        (1) | 7 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah | P63092 | 
| #174800 | Mccune-albright syndrome; mas | P63092 | 
| #166350 | Osseous heteroplasia, progressive; poh | P63092 | 
| #102200 | Pituitary adenoma, growth hormone-secreting | P63092 | 
| #103580 | Pseudohypoparathyroidism, type ia; php1a | P63092 | 
| #603233 | Pseudohypoparathyroidism, type ib; php1b | P63092 | 
| #612462 | Pseudohypoparathyroidism, type ic; php1c | P63092 |