id | C00024433 |
---|---|
Name | Pseudolycorine |
CAS RN | 29429-03-6 |
Standard InChI | InChI=1S/C16H19NO4/c1-21-13-5-9-7-17-3-2-8-4-12(19)16(20)14(15(8)17)10(9)6-11(13)18/h4-6,12,14-16,18-20H,2-3,7H2,1H3/t12-,14-,15+,16+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C16H19NO4/c1-21-13-5-9-7-17-3-2-8-4-12(19)16(20)14(15(8)17)10(9)6-11(13)18/h4-6,12,14-16,18-20H,2-3,7H2,1H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 633 |
By standard InChI | CHEMBL586091 |
---|---|
By standard InChI Main Layer | CHEMBL586091 CHEMBL2007837 |
By LinkDB | C12187 |
---|
By CAS RN | C027861 |
---|
class name | count |
---|---|
Liliopsida | 8 |
family name | count |
---|---|
Amaryllidaceae | 8 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL586091 |
CHEMBL1227598
(1)
|
1 / 0 |