| id | C00024443 |
|---|---|
| Name | Ungminorine / Deacetyllutessine / O-Deacetyllutessine |
| CAS RN | 27857-09-6 |
| Standard InChI | InChI=1S/C17H19NO5/c1-21-17-15(19)9-2-3-18-6-8-4-11-12(23-7-22-11)5-10(8)13(14(9)18)16(17)20/h2,4-5,13-17,19-20H,3,6-7H2,1H3/t13-,14+,15+,16-,17-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H19NO5/c1-21-17-15(19)9-2-3-18-6-8-4-11-12(23-7-22-11)5-10(8)13(14(9)18)16(17)20/h2,4-5,13-17,19-20H,3,6-7H2,1H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 860 |
| By standard InChI | CHEMBL497276 |
|---|---|
| By standard InChI Main Layer | CHEMBL497276 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Amaryllidaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ungernia vvedenskyi | 82252 | Amaryllidaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL497276 |
CHEMBL974116
(1)
|
1 / 0 |