| id | C00024671 |
|---|---|
| Name | 1-Methylcarbazole |
| CAS RN | 6510-65-2 |
| Standard InChI | InChI=1S/C13H11N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-8,14H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C13H11N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-8,14H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 751 |
| By standard InChI | CHEMBL444714 |
|---|---|
| By standard InChI Main Layer | CHEMBL444714 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Tedaniidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tedania ignis | 278976 | Tedaniidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P52732 | Kinesin-like protein KIF11 | Other cytosolic protein | CHEMBL444714 |
CHEMBL1177082
(1)
|
1 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #152950 | Microcephaly with or without chorioretinopathy, lymphedema, or mental retardation; mclmr |
P52732
|