| id | C00024873 |
|---|---|
| Name | Delfissinol / (-)-Delfissinol |
| CAS RN | 152606-55-8 |
| Standard InChI | InChI=1S/C20H27NO3/c1-8-6-20-10-12(22)9(8)13(23)15(20)19-5-3-4-18(2)7-21(16(10)19)11(14(18)19)17(20)24/h9-17,22-24H,1,3-7H2,2H3/t9-,10+,11+,12?,13+,14+,15-,16?,17-,18+,19-,20?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H27NO3/c1-8-6-20-10-12(22)9(8)13(23)15(20)19-5-3-4-18(2)7-21(16(10)19)11(14(18)19)17(20)24/h9-17,22-24H,1,3-7H2,2H3 |
| Phytochemical cluster | No. 10 |
|---|---|
| KCF-S cluster | No. 121 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Ranunculaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aconitum fissum subsp. anatolicum | 49188 | Ranunculaceae | eudicotyledons | Viridiplantae |