| id | C00025043 |
|---|---|
| Name | Craspidospermine / 11-Methoxycriocerine / (-)-Craspidospermine |
| CAS RN | 59373-42-1 |
| Standard InChI | InChI=1S/C22H24N2O4/c1-4-21-12-22(20(25)27-3)24-16-11-13(26-2)5-6-14(16)15-7-9-23(19(21)18(15)24)10-8-17(21)28-22/h5-6,8,10-11,17,19H,4,7,9,12H2,1-3H3/t17-,19-,21-,22+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H24N2O4/c1-4-21-12-22(20(25)27-3)24-16-11-13(26-2)5-6-14(16)15-7-9-23(19(21)18(15)24)10-8-17(21)28-22/h5-6,8,10-11,17,19H,4,7,9,12H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 452 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Apocynaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Craspidospermum verticillatum | 184384 | Apocynaceae | asterids | Viridiplantae |