| id | C00002530 | 
|---|---|
| Name | (-)-Glyceollin I | 
| CAS RN | 57103-57-8 | 
| Standard InChI | InChI=1S/C20H18O5/c1-19(2)8-7-12-15(25-19)6-4-13-17(12)23-10-20(22)14-5-3-11(21)9-16(14)24-18(13)20/h3-9,18,21-22H,10H2,1-2H3/t18-,20+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H18O5/c1-19(2)8-7-12-15(25-19)6-4-13-17(12)23-10-20(22)14-5-3-11(21)9-16(14)24-18(13)20/h3-9,18,21-22H,10H2,1-2H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 325 | 
| By standard InChI | CHEMBL1774987 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1774987 CHEMBL1774988 CHEMBL1774989 | 
| By LinkDB | C01701 | 
|---|
| By CAS RN | C017343 | 
|---|
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C017343 | 2099 | ESR1 ER ESR ESRA ESTRR Era NR3A1 | estrogen receptor 1 | glyceollin binds to ESR1 protein | affects binding | protein | 19797619 | 
| C017343 | 2099 | ESR1 ER ESR ESRA ESTRR Era NR3A1 | estrogen receptor 1 | glyceollin inhibits the reaction [Estradiol binds to ESR1 protein] | affects binding / decreases reaction | protein | 19797619 | 
| C017343 | 4804 | NGFR CD271 Gp80-LNGFR TNFRSF16 p75(NTR) p75NTR | nerve growth factor receptor | glyceollin results in increased expression of NGFR mRNA | increases expression | mRNA | 19797619 | 
| C017343 | 5241 | PGR NR3C3 PR | progesterone receptor | glyceollin inhibits the reaction [Estradiol results in increased expression of PGR mRNA] | decreases reaction / increases expression | mRNA | 19797619 | 
| C017343 | 5241 | PGR NR3C3 PR | progesterone receptor | glyceollin inhibits the reaction [Estrogens results in increased expression of PGR mRNA] | decreases reaction / increases expression | mRNA | 19797619 | 
| C017343 | 5241 | PGR NR3C3 PR | progesterone receptor | [Tamoxifen co-treated with glyceollin] results in decreased expression of PGR mRNA | affects cotreatment / decreases expression | mRNA | 19797619 | 
| C017343 | 100195758 | glyceollin inhibits the reaction [Estradiol results in increased expression of SDF1 mRNA] | decreases reaction / increases expression | mRNA | 19797619 | ||
| C017343 | 100195758 | glyceollin inhibits the reaction [Estrogens results in increased expression of SDF1 mRNA] | decreases reaction / increases expression | mRNA | 19797619 | ||
| C017343 | 100195758 | [Tamoxifen co-treated with glyceollin] results in decreased expression of SDF1 mRNA | affects cotreatment / decreases expression | mRNA | 19797619 |