| id | C00025790 |
|---|---|
| Name | Cepharanone A |
| CAS RN | 55610-00-9 |
| Standard InChI | InChI=1S/C16H9NO3/c18-16-10-6-12-15(20-7-19-12)14-9-4-2-1-3-8(9)5-11(17-16)13(10)14/h1-6H,7H2,(H,17,18) |
| Standard InChI (Main Layer) | InChI=1S/C16H9NO3/c18-16-10-6-12-15(20-7-19-12)14-9-4-2-1-3-8(9)5-11(17-16)13(10)14/h1-6H,7H2,(H,17,18) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 125 |
| By standard InChI | CHEMBL603073 |
|---|---|
| By standard InChI Main Layer | CHEMBL603073 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania cepharantha Hayata | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL603073 |
CHEMBL1067148
(1)
CHEMBL1067154
(1)
|
0 / 0 |