| id | C00025952 |
|---|---|
| Name | N-Acetylstepharine |
| CAS RN | 4880-87-9 |
| Standard InChI | InChI=1S/C20H21NO4/c1-12(22)21-9-6-13-10-16(24-2)19(25-3)18-17(13)15(21)11-20(18)7-4-14(23)5-8-20/h4-5,7-8,10,15H,6,9,11H2,1-3H3/t15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H21NO4/c1-12(22)21-9-6-13-10-16(24-2)19(25-3)18-17(13)15(21)11-20(18)7-4-14(23)5-8-20/h4-5,7-8,10,15H,6,9,11H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 688 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1712129 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania rotunda Lour. | 461634 | Menispermaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL1712129 |
CHEMBL1794585
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1712129 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1712129 |
CHEMBL1738588
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1712129 |
CHEMBL1794483
(1)
|
0 / 0 |