| id | C00025955 |
|---|---|
| Name | N-Formylanonaine |
| CAS RN | 83459-45-4 |
| Standard InChI | InChI=1S/C18H15NO3/c20-9-19-6-5-12-8-15-18(22-10-21-15)17-13-4-2-1-3-11(13)7-14(19)16(12)17/h1-4,8-9,14H,5-7,10H2/t14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H15NO3/c20-9-19-6-5-12-8-15-18(22-10-21-15)17-13-4-2-1-3-11(13)7-14(19)16(12)17/h1-4,8-9,14H,5-7,10H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 553 |
| By standard InChI | CHEMBL1170090 |
|---|---|
| By standard InChI Main Layer | CHEMBL1170090 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Menispermaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tinospora crispa Miers | 41789 | Menispermaceae | eudicotyledons | Viridiplantae |
| Tinospora malabarica Miers | 41789 | Menispermaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL1170090 |
CHEMBL1175848
(1)
CHEMBL1175849
(1)
|
4 / 2 |