| id | C00025955 | 
|---|---|
| Name | N-Formylanonaine | 
| CAS RN | 83459-45-4 | 
| Standard InChI | InChI=1S/C18H15NO3/c20-9-19-6-5-12-8-15-18(22-10-21-15)17-13-4-2-1-3-11(13)7-14(19)16(12)17/h1-4,8-9,14H,5-7,10H2/t14-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C18H15NO3/c20-9-19-6-5-12-8-15-18(22-10-21-15)17-13-4-2-1-3-11(13)7-14(19)16(12)17/h1-4,8-9,14H,5-7,10H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 553 | 
| By standard InChI | CHEMBL1170090 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1170090 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 2 | 
| family name | count | 
|---|---|
| Menispermaceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Tinospora crispa Miers | 41789 | Menispermaceae | eudicotyledons | Viridiplantae | 
| Tinospora malabarica Miers | 41789 | Menispermaceae | eudicotyledons | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL1170090 | CHEMBL1175848
                        (1)
                        CHEMBL1175849
                        (1) | 4 / 2 |