| id | C00026237 |
|---|---|
| Name | Candidine / Qingdainone |
| CAS RN | 97457-31-3 |
| Standard InChI | InChI=1S/C23H13N3O2/c27-21-13-7-1-4-10-16(13)24-20(21)19-15-9-3-6-12-18(15)26-22(19)25-17-11-5-2-8-14(17)23(26)28/h1-12,24H/b20-19+ |
| Standard InChI (Main Layer) | InChI=1S/C23H13N3O2/c27-21-13-7-1-4-10-16(13)24-20(21)19-15-9-3-6-12-18(15)26-22(19)25-17-11-5-2-8-14(17)23(26)28/h1-12,24H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8411 |
| By standard InChI | CHEMBL375647 |
|---|---|
| By standard InChI Main Layer | CHEMBL375647 CHEMBL503442 |
| By LinkDB |
|---|
| By CAS RN | C046244 |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Candida lipolitica | 5475 | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P15559 | NAD(P)H dehydrogenase [quinone] 1 | Enzyme | CHEMBL375647 |
CHEMBL911952
(1)
|
0 / 0 |