| id | C00026349 |
|---|---|
| Name | Lepadin E / Lepadine E / (-)-Lepadin E / (-)-Lepadine E |
| CAS RN | 444914-19-6 |
| Standard InChI | InChI=1S/C26H47NO3/c1-4-6-7-8-9-18-26(29)30-25-19-23-21(14-10-11-16-22(28)13-5-2)15-12-17-24(23)27-20(25)3/h9,18,20-25,27-28H,4-8,10-17,19H2,1-3H3/b18-9+/t20-,21-,22+,23-,24+,25+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H47NO3/c1-4-6-7-8-9-18-26(29)30-25-19-23-21(14-10-11-16-22(28)13-5-2)15-12-17-24(23)27-20(25)3/h9,18,20-25,27-28H,4-8,10-17,19H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1529 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL431063 CHEMBL104718 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Didemnidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Didemnum sp. | 107395 | Didemnidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL431063 CHEMBL104718 |
CHEMBL841383
(2)
|
0 / 1 |