| id | C00026349 | 
|---|---|
| Name | Lepadin E / Lepadine E / (-)-Lepadin E / (-)-Lepadine E | 
| CAS RN | 444914-19-6 | 
| Standard InChI | InChI=1S/C26H47NO3/c1-4-6-7-8-9-18-26(29)30-25-19-23-21(14-10-11-16-22(28)13-5-2)15-12-17-24(23)27-20(25)3/h9,18,20-25,27-28H,4-8,10-17,19H2,1-3H3/b18-9+/t20-,21-,22+,23-,24+,25+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C26H47NO3/c1-4-6-7-8-9-18-26(29)30-25-19-23-21(14-10-11-16-22(28)13-5-2)15-12-17-24(23)27-20(25)3/h9,18,20-25,27-28H,4-8,10-17,19H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1529 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL431063 CHEMBL104718 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Didemnidae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Didemnum sp. | 107395 | Didemnidae | Metazoa | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL431063 CHEMBL104718 | CHEMBL841383
                        (2) | 0 / 1 |