| id | C00026569 | 
|---|---|
| Name | Bengacarboline | 
| CAS RN | 192947-81-2 | 
| Standard InChI | InChI=1S/C29H27N5/c30-15-13-20-18-7-1-5-11-25(18)33-27(20)29(23-17-31-24-10-4-3-9-22(23)24)28-21(14-16-32-29)19-8-2-6-12-26(19)34-28/h1-12,17,31-34H,13-16,30H2/t29-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C29H27N5/c30-15-13-20-18-7-1-5-11-25(18)33-27(20)29(23-17-31-24-10-4-3-9-22(23)24)28-21(14-16-32-29)19-8-2-6-12-26(19)34-28/h1-12,17,31-34H,13-16,30H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7959 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL257249 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Didemnidae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Didemnum sp. | 107395 | Didemnidae | Metazoa | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL257249 | CHEMBL933183
                        (1) | 0 / 0 |