| id | C00026569 |
|---|---|
| Name | Bengacarboline |
| CAS RN | 192947-81-2 |
| Standard InChI | InChI=1S/C29H27N5/c30-15-13-20-18-7-1-5-11-25(18)33-27(20)29(23-17-31-24-10-4-3-9-22(23)24)28-21(14-16-32-29)19-8-2-6-12-26(19)34-28/h1-12,17,31-34H,13-16,30H2/t29-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H27N5/c30-15-13-20-18-7-1-5-11-25(18)33-27(20)29(23-17-31-24-10-4-3-9-22(23)24)28-21(14-16-32-29)19-8-2-6-12-26(19)34-28/h1-12,17,31-34H,13-16,30H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7959 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL257249 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Didemnidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Didemnum sp. | 107395 | Didemnidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL257249 |
CHEMBL933183
(1)
|
0 / 0 |