| id | C00026599 |
|---|---|
| Name | Calothrixin B |
| CAS RN | 254114-34-6 |
| Standard InChI | InChI=1S/C19H10N2O2/c22-18-12-9-20-13-7-3-1-5-10(13)15(12)19(23)17-16(18)11-6-2-4-8-14(11)21-17/h1-9,21H |
| Standard InChI (Main Layer) | InChI=1S/C19H10N2O2/c22-18-12-9-20-13-7-3-1-5-10(13)15(12)19(23)17-16(18)11-6-2-4-8-14(11)21-17/h1-9,21H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5495 |
| By standard InChI | CHEMBL362573 |
|---|---|
| By standard InChI Main Layer | CHEMBL362573 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Rivulariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calothrix sp. | 1187 | Rivulariaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL362573 |
CHEMBL1062110
(1)
CHEMBL1062112
(1)
|
0 / 0 |