| id | C00026623 |
|---|---|
| Name | Fellutanine A |
| CAS RN | 175414-35-4 |
| Standard InChI | InChI=1S/C22H20N4O2/c27-21-19(9-13-11-23-17-7-3-1-5-15(13)17)25-22(28)20(26-21)10-14-12-24-18-8-4-2-6-16(14)18/h1-8,11-12,19-20,23-24H,9-10H2,(H,25,28)(H,26,27)/t19-,20+ |
| Standard InChI (Main Layer) | InChI=1S/C22H20N4O2/c27-21-19(9-13-11-23-17-7-3-1-5-15(13)17)25-22(28)20(26-21)10-14-12-24-18-8-4-2-6-16(14)18/h1-8,11-12,19-20,23-24H,9-10H2,(H,25,28)(H,26,27) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3891 |
| By standard InChI | CHEMBL496646 |
|---|---|
| By standard InChI Main Layer | CHEMBL191011 CHEMBL496646 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| Micromonosporaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Micromonospora sp. | 1876 | Micromonosporaceae | Bacteria | |
| Penicillium fellutanum | 70095 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P07384 | Calpain-1 catalytic subunit | C2 | CHEMBL191011 |
CHEMBL836124
(1)
|
0 / 0 |