| id | C00026660 |
|---|---|
| Name | Lycoperodine 1 / 3-Carboxy-1,2,3,4-tetrahydro-beta-carboline / (-)-3-Carboxy-1,2,3,4-tetrahydro-beta-carboline |
| CAS RN | 42438-90-4 |
| Standard InChI | InChI=1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16)/t10-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3209 |
| By standard InChI | CHEMBL155546 |
|---|---|
| By standard InChI Main Layer | CHEMBL149177 CHEMBL155546 CHEMBL1915148 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Solanaceae | 1 |
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lycopersicon esculentum | 4081 | Solanaceae | asterids | Viridiplantae |
| Taraxacum formosanum | 170733 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL155546 CHEMBL1915148 |
CHEMBL1918237
(2)
|
2 / 2 |