| id | C00026777 |
|---|---|
| Name | 8-Hydroxymanzamine A |
| CAS RN | 154466-37-2 |
| Standard InChI | InChI=1S/C36H44N4O2/c41-30-14-11-13-26-27-15-18-37-32(33(27)38-31(26)30)28-23-36(42)17-8-4-1-2-5-9-19-39-21-16-29(28)35(24-39)22-25-12-7-3-6-10-20-40(25)34(35)36/h1,4,7,11-15,18,23,25,29,34,38,41-42H,2-3,5-6,8-10,16-17,19-22,24H2/b4-1+,12-7-/t25-,29-,34+,35-,36-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C36H44N4O2/c41-30-14-11-13-26-27-15-18-37-32(33(27)38-31(26)30)28-23-36(42)17-8-4-1-2-5-9-19-39-21-16-29(28)35(24-39)22-25-12-7-3-6-10-20-40(25)34(35)36/h1,4,7,11-15,18,23,25,29,34,38,41-42H,2-3,5-6,8-10,16-17,19-22,24H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 737 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL404709 CHEMBL612054 |
| By LinkDB |
|---|
| By CAS RN | C086783 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Niphatidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acanthostrongylophora sp. | ||||
| Amphimedon sp. | 178513 | Niphatidae | Metazoa | |
| Pachypellina sp. | ||||
| Xestospongia sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49841 | Glycogen synthase kinase-3 beta | Gsk | CHEMBL612054 |
CHEMBL926489
(1)
CHEMBL926490
(1)
CHEMBL966427 (1) CHEMBL966428 (1) |
0 / 0 |
| P56817 | Beta-secretase 1 | A1A | CHEMBL612054 |
CHEMBL980251
(1)
|
0 / 0 |