| id | C00026778 | 
|---|---|
| Name | Manzamine B / (+)-Manzamine B | 
| CAS RN | 112663-92-0 | 
| Standard InChI | InChI=1S/C36H46N4O/c1-3-7-13-21-38-34-35(19-11-5-1)25-40-23-14-8-4-2-6-12-20-36(34)33(41-36)30(28(35)18-24-40)32-31-27(17-22-37-32)26-15-9-10-16-29(26)39-31/h1-2,5-6,9-10,15-17,22,28,30,33-34,38-39H,3-4,7-8,11-14,18-21,23-25H2/b5-1-,6-2+ | 
| Standard InChI (Main Layer) | InChI=1S/C36H46N4O/c1-3-7-13-21-38-34-35(19-11-5-1)25-40-23-14-8-4-2-6-12-20-36(34)33(41-36)30(28(35)18-24-40)32-31-27(17-22-37-32)26-15-9-10-16-29(26)39-31/h1-2,5-6,9-10,15-17,22,28,30,33-34,38-39H,3-4,7-8,11-14,18-21,23-25H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4296 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL507145 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Pellina sp. | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL507145 | 
                        CHEMBL980251
                        (1)
                         | 
                      0 / 0 |