| id | C00026830 |
|---|---|
| Name | Alstonisine |
| CAS RN | 35804-91-2 |
| Standard InChI | InChI=1S/C20H22N2O3/c1-11(23)13-9-25-10-14-12(13)7-18-20(8-16(14)21-18)15-5-3-4-6-17(15)22(2)19(20)24/h3-6,9,12,14,16,18,21H,7-8,10H2,1-2H3/t12-,14+,16-,18-,20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H22N2O3/c1-11(23)13-9-25-10-14-12(13)7-18-20(8-16(14)21-18)15-5-3-4-6-17(15)22(2)19(20)24/h3-6,9,12,14,16,18,21H,7-8,10H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1224 |
| By standard InChI | CHEMBL592449 |
|---|---|
| By standard InChI Main Layer | CHEMBL592449 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 4 |
| family name | count |
|---|---|
| Apocynaceae | 4 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alstonia angustifolia Wall | 52821 | Apocynaceae | asterids | Viridiplantae |
| Alstonia angustifolia var.latifolia | 52821 | Apocynaceae | asterids | Viridiplantae |
| Alstonia macrophylla | 693366 | Apocynaceae | asterids | Viridiplantae |
| Alstonia muelleriana Domin | 52821 | Apocynaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL592449 |
CHEMBL1070175
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL592449 |
CHEMBL1070176
(1)
|
1 / 1 |