| id | C00026841 |
|---|---|
| Name | Makaluvamine O |
| CAS RN | 420838-31-9 |
| Standard InChI | InChI=1S/C10H7BrN2O2/c11-6-7-5-4(1-2-12-7)3-13-8(5)10(15)9(6)14/h3,12-13H,1-2H2 |
| Standard InChI (Main Layer) | InChI=1S/C10H7BrN2O2/c11-6-7-5-4(1-2-12-7)3-13-8(5)10(15)9(6)14/h3,12-13H,1-2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2288 |
| By standard InChI | CHEMBL511880 |
|---|---|
| By standard InChI Main Layer | CHEMBL511880 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Thorectidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Smenospongia aurea | 289409 | Thorectidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL511880 |
CHEMBL1012216
(1)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL511880 |
CHEMBL1012217
(1)
|
0 / 0 |