| id | C00026909 |
|---|---|
| Name | N-Palmitoyltryptamine |
| CAS RN | 21469-15-8 |
| Standard InChI | InChI=1S/C26H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-26(29)27-21-20-23-22-28-25-18-16-15-17-24(23)25/h15-18,22,28H,2-14,19-21H2,1H3,(H,27,29) |
| Standard InChI (Main Layer) | InChI=1S/C26H42N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-26(29)27-21-20-23-22-28-25-18-16-15-17-24(23)25/h15-18,22,28H,2-14,19-21H2,1H3,(H,27,29) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 442 |
| By standard InChI | CHEMBL491543 |
|---|---|
| By standard InChI Main Layer | CHEMBL491543 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Annonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rollinia mucosa | 301699 | Annonaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL491543 |
CHEMBL1738312
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL491543 |
CHEMBL2114843
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL491543 |
CHEMBL1794483
(1)
|
0 / 0 |