| id | C00002699 |
|---|---|
| Name | 4'-Hydroxy-3'-phenylacetophenone |
| CAS RN | 35816-89-8 |
| Standard InChI | InChI=1S/C13H16O2/c1-9(2)4-5-12-8-11(10(3)14)6-7-13(12)15/h4,6-8,15H,5H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C13H16O2/c1-9(2)4-5-12-8-11(10(3)14)6-7-13(12)15/h4,6-8,15H,5H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2709 |
| By standard InChI | CHEMBL500601 |
|---|---|
| By standard InChI Main Layer | CHEMBL500601 |
| By LinkDB | C10702 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Polymnia sonchifolia | 183069 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P42858 | Huntingtin | Unclassified protein | CHEMBL500601 |
CHEMBL1613918
(1)
|
1 / 1 |