| id | C00027023 |
|---|---|
| Name | Debromoflustramine B |
| CAS RN | 158060-73-2 |
| Standard InChI | InChI=1S/C21H30N2/c1-16(2)10-12-21-13-15-22(5)20(21)23(14-11-17(3)4)19-9-7-6-8-18(19)21/h6-11,20H,12-15H2,1-5H3/t20-,21+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H30N2/c1-16(2)10-12-21-13-15-22(5)20(21)23(14-11-17(3)4)19-9-7-6-8-18(19)21/h6-11,20H,12-15H2,1-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2016 |
| By standard InChI | CHEMBL383307 |
|---|---|
| By standard InChI Main Layer | CHEMBL383307 CHEMBL452834 CHEMBL452582 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Flustridae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Flustra foliacea | 478208 | Flustridae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06276 | Cholinesterase | Hydrolase | CHEMBL383307 CHEMBL452834 CHEMBL452582 |
CHEMBL1000390
(3)
CHEMBL1000391
(1)
|
0 / 0 |