| id | C00027080 |
|---|---|
| Name | cis-N-(p-Coumaroyl)serotonin |
| CAS RN | 314298-49-2 |
| Standard InChI | InChI=1S/C19H18N2O3/c22-15-4-1-13(2-5-15)3-8-19(24)20-10-9-14-12-21-18-7-6-16(23)11-17(14)18/h1-8,11-12,21-23H,9-10H2,(H,20,24)/b8-3- |
| Standard InChI (Main Layer) | InChI=1S/C19H18N2O3/c22-15-4-1-13(2-5-15)3-8-19(24)20-10-9-14-12-21-18-7-6-16(23)11-17(14)18/h1-8,11-12,21-23H,9-10H2,(H,20,24) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1533 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1760547 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Araceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Amorphophallus konjac K.Koch | 78372 | Araceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1760547 |
CHEMBL2016144
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL1760547 |
CHEMBL2016143
(1)
|
0 / 0 |