| id | C00027082 |
|---|---|
| Name | Tsitsikammamine A |
| CAS RN | 183114-86-5 |
| Standard InChI | InChI=1S/C18H13N3O2/c22-11-3-1-9(2-4-11)12-8-21-17-14(12)15-13-10(5-6-19-15)7-20-16(13)18(17)23/h1-4,7-8,20-22H,5-6H2 |
| Standard InChI (Main Layer) | InChI=1S/C18H13N3O2/c22-11-3-1-9(2-4-11)12-8-21-17-14(12)15-13-10(5-6-19-15)7-20-16(13)18(17)23/h1-4,7-8,20-22H,5-6H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3140 |
| By standard InChI | CHEMBL457826 |
|---|---|
| By standard InChI Main Layer | CHEMBL457826 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Latrunculiidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tsitsikamma favus | 1035643 | Latrunculiidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL457826 |
CHEMBL1000099
(1)
|
0 / 0 |