| id | C00002715 | 
|---|---|
| Name | beta-Asarone | 
| CAS RN | 5273-86-9 | 
| Standard InChI | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5- | 
| Standard InChI (Main Layer) | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3 | 
| Phytochemical cluster | No. 6 | 
|---|---|
| KCF-S cluster | No. 723 | 
| By standard InChI | CHEMBL477752 | 
|---|---|
| By standard InChI Main Layer | CHEMBL333306 CHEMBL477752 | 
| By LinkDB | C10430 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 2 | 
| Magnoliophyta | 2 | 
| family name | count | 
|---|---|
| Acoraceae | 2 | 
| Aristolochiaceae | 1 | 
| Piperaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Acorus calamus | 4465 | Acoraceae | Liliopsida | Viridiplantae | 
| Acorus calanus L. | 4464 | Acoraceae | Liliopsida | Viridiplantae | 
| Asarum europaeum | 49456 | Aristolochiaceae | Magnoliophyta | Viridiplantae | 
| Piper angustifolium | 13215 | Piperaceae | Magnoliophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL333306 | CHEMBL970954
                        (1) | 1 / 0 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL333306 | CHEMBL970953
                        (1) | 0 / 1 |