| id | C00027266 |
|---|---|
| Name | Aaptamine |
| CAS RN | 85547-22-4 |
| Standard InChI | InChI=1S/C13H12N2O2/c1-16-10-7-8-3-5-14-9-4-6-15-12(11(8)9)13(10)17-2/h3-7,15H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C13H12N2O2/c1-16-10-7-8-3-5-14-9-4-6-15-12(11(8)9)13(10)17-2/h3-7,15H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3079 |
| By standard InChI | CHEMBL234658 |
|---|---|
| By standard InChI Main Layer | CHEMBL234658 |
| By LinkDB |
|---|
| By CAS RN | C043986 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Suberitidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aaptos aaptos | 253165 | Suberitidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q06210 | Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 1 | Enzyme | CHEMBL234658 |
CHEMBL1912274
(1)
|
1 / 0 |
| Q99814 | Endothelial PAS domain-containing protein 1 | Unclassified protein | CHEMBL234658 |
CHEMBL2184390
(1)
|
1 / 1 |