id | C00027266 |
---|---|
Name | Aaptamine |
CAS RN | 85547-22-4 |
Standard InChI | InChI=1S/C13H12N2O2/c1-16-10-7-8-3-5-14-9-4-6-15-12(11(8)9)13(10)17-2/h3-7,15H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C13H12N2O2/c1-16-10-7-8-3-5-14-9-4-6-15-12(11(8)9)13(10)17-2/h3-7,15H,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 3079 |
By standard InChI | CHEMBL234658 |
---|---|
By standard InChI Main Layer | CHEMBL234658 |
By LinkDB |
---|
By CAS RN | C043986 |
---|
class name | count |
---|
family name | count |
---|---|
Suberitidae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Aaptos aaptos | 253165 | Suberitidae | Metazoa |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q06210 | Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 1 | Enzyme | CHEMBL234658 |
CHEMBL1912274
(1)
|
1 / 0 |
Q99814 | Endothelial PAS domain-containing protein 1 | Unclassified protein | CHEMBL234658 |
CHEMBL2184390
(1)
|
1 / 1 |