| id | C00027445 |
|---|---|
| Name | Tuberosine B / trans-N-Feruloyldopamine / N-trans-Feruloyldopamine |
| CAS RN | 142350-99-0 |
| Standard InChI | InChI=1S/C18H19NO5/c1-24-17-11-12(3-6-15(17)21)4-7-18(23)19-9-8-13-2-5-14(20)16(22)10-13/h2-7,10-11,20-22H,8-9H2,1H3,(H,19,23)/b7-4+ |
| Standard InChI (Main Layer) | InChI=1S/C18H19NO5/c1-24-17-11-12(3-6-15(17)21)4-7-18(23)19-9-8-13-2-5-14(20)16(22)10-13/h2-7,10-11,20-22H,8-9H2,1H3,(H,19,23) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 499 |
| By standard InChI | CHEMBL202844 |
|---|---|
| By standard InChI Main Layer | CHEMBL202844 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Amaryllidaceae | 1 |
| Piperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Allium tuberosum | 4683 | Amaryllidaceae | Liliopsida | Viridiplantae |
| Peperomia duclouxii | 13196 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL202844 |
CHEMBL870666
(1)
|
4 / 2 |