| id | C00027518 |
|---|---|
| Name | Aristolochic acid III |
| CAS RN | 7267-92-7 |
| Standard InChI | InChI=1S/C17H11NO7/c1-23-9-3-2-8-4-12(18(21)22)14-11(17(19)20)6-13-16(25-7-24-13)15(14)10(8)5-9/h2-6H,7H2,1H3,(H,19,20) |
| Standard InChI (Main Layer) | InChI=1S/C17H11NO7/c1-23-9-3-2-8-4-12(18(21)22)14-11(17(19)20)6-13-16(25-7-24-13)15(14)10(8)5-9/h2-6H,7H2,1H3,(H,19,20) |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 291 |
| By standard InChI | CHEMBL601027 |
|---|---|
| By standard InChI Main Layer | CHEMBL601027 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 2 |
| family name | count |
|---|---|
| Aristolochiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aristolochia auricularia | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| Aristolochia cinnabarina | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL601027 |
CHEMBL1067148
(1)
CHEMBL1067154
(1)
|
0 / 0 |