| id | C00027644 | 
|---|---|
| Name | (E)-7-Methoxytetradec-4-enoic acid | 
| CAS RN | 142185-10-2 | 
| Standard InChI | InChI=1S/C15H28O3/c1-3-4-5-6-8-11-14(18-2)12-9-7-10-13-15(16)17/h7,9,14H,3-6,8,10-13H2,1-2H3,(H,16,17)/b9-7+ | 
| Standard InChI (Main Layer) | InChI=1S/C15H28O3/c1-3-4-5-6-8-11-14(18-2)12-9-7-10-13-15(16)17/h7,9,14H,3-6,8,10-13H2,1-2H3,(H,16,17) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7357 | 
| By standard InChI | CHEMBL1808196 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1808196 CHEMBL1808197 CHEMBL1808198 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1808197 | CHEMBL2114784
                        (1) | 1 / 1 | 
| O75496 | Geminin | Unclassified protein | CHEMBL1808197 | CHEMBL2114780
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1808197 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1808197 | CHEMBL1794401
                        (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1808197 | CHEMBL1794483
                        (1) | 0 / 0 | 
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1808197 | CHEMBL2354287
                        (1) | 1 / 1 |